C23H20N4O3S2 — CID 55514740
(E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide (PubChem CID 55514740) has the molecular formula C23H20N4O3S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is (E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55514740 |
| Molecular Formula | C23H20N4O3S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | (E)-N-(6-acetamido-1,3-benzothiazol-2-yl)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enamide |
| SMILES | CC(=O)Nc1ccc2nc(NC(=O)/C=C/c3ccccc3OCc3csc(C)n3)sc2c1 |
| InChI | InChI=1S/C23H20N4O3S2/c1-14(28)24-17-8-9-19-21(11-17)32-23(26-19)27-22(29)10-7-16-5-3-4-6-20(16)30-12-18-13-31-15(2)25-18/h3-11,13H,12H2,1-2H3,(H,24,28)(H,26,27,29)/b10-7+ |
| InChIKey | NMKNTKHXVIPXLA-JXMROGBWSA-N |
| XLogP | 5.25 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|