C24H24N2O4S — CID 24612144
methyl 3-[[(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]-3-phenylpropanoate (PubChem CID 24612144) has the molecular formula C24H24N2O4S and a molecular weight of 436.53 g/mol. Its IUPAC name is methyl 3-[[(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 3-[[(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 24612144 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | methyl 3-[[(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)CC(NC(=O)/C=C/c1ccccc1OCc1csc(C)n1)c1ccccc1 |
| InChI | InChI=1S/C24H24N2O4S/c1-17-25-20(16-31-17)15-30-22-11-7-6-10-19(22)12-13-23(27)26-21(14-24(28)29-2)18-8-4-3-5-9-18/h3-13,16,21H,14-15H2,1-2H3,(H,26,27)/b13-12+ |
| InChIKey | MVUUBRWMODBSKY-OUKQBFOZSA-N |
| XLogP | 4.46 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|