C25H28N2O5S — CID 55709301
3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-enamide (PubChem CID 55709301) has the molecular formula C25H28N2O5S and a molecular weight of 468.58 g/mol. Its IUPAC name is 3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-enamide.
| Compound Name | 3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55709301 |
| Molecular Formula | C25H28N2O5S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | 3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[1-(3,4,5-trimethoxyphenyl)ethyl]prop-2-enamide |
| SMILES | COc1cc(C(C)NC(=O)C=Cc2ccccc2OCc2csc(C)n2)cc(OC)c1OC |
| InChI | InChI=1S/C25H28N2O5S/c1-16(19-12-22(29-3)25(31-5)23(13-19)30-4)26-24(28)11-10-18-8-6-7-9-21(18)32-14-20-15-33-17(2)27-20/h6-13,15-16H,14H2,1-5H3,(H,26,28) |
| InChIKey | HBOKCJCPBSGENY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|