C28H27N3O3S — CID 46463413
(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]prop-2-enamide (PubChem CID 46463413) has the molecular formula C28H27N3O3S and a molecular weight of 485.61 g/mol. Its IUPAC name is (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 46463413 |
| Molecular Formula | C28H27N3O3S |
| Molecular Weight | 485.61 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]-N-[1-[4-(pyridin-3-ylmethoxy)phenyl]ethyl]prop-2-enamide |
| SMILES | Cc1nc(COc2ccccc2/C=C/C(=O)NC(C)c2ccc(OCc3cccnc3)cc2)cs1 |
| InChI | InChI=1S/C28H27N3O3S/c1-20(23-9-12-26(13-10-23)33-17-22-6-5-15-29-16-22)30-28(32)14-11-24-7-3-4-8-27(24)34-18-25-19-35-21(2)31-25/h3-16,19-20H,17-18H2,1-2H3,(H,30,32)/b14-11+ |
| InChIKey | NECWUCFQZMDAIX-SDNWHVSQSA-N |
| XLogP | 5.90 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.61 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|