C24H32N4O3S — CID 55491606
N,N-diethyl-2-[4-[(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]piperazin-1-yl]acetamide (PubChem CID 55491606) has the molecular formula C24H32N4O3S and a molecular weight of 456.61 g/mol. Its IUPAC name is N,N-diethyl-2-[4-[(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]piperazin-1-yl]acetamide.
| Compound Name | N,N-diethyl-2-[4-[(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55491606 |
| Molecular Formula | C24H32N4O3S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | N,N-diethyl-2-[4-[(E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]piperazin-1-yl]acetamide |
| SMILES | CCN(CC)C(=O)CN1CCN(C(=O)/C=C/c2ccccc2OCc2csc(C)n2)CC1 |
| InChI | InChI=1S/C24H32N4O3S/c1-4-27(5-2)24(30)16-26-12-14-28(15-13-26)23(29)11-10-20-8-6-7-9-22(20)31-17-21-18-32-19(3)25-21/h6-11,18H,4-5,12-17H2,1-3H3/b11-10+ |
| InChIKey | IIIVLMQSPXRYGJ-ZHACJKMWSA-N |
| XLogP | 3.06 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|