C21H25N3O3S — CID 72687206
4-[3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]-3-propan-2-ylpiperazin-2-one (PubChem CID 72687206) has the molecular formula C21H25N3O3S and a molecular weight of 399.52 g/mol. Its IUPAC name is 4-[3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]-3-propan-2-ylpiperazin-2-one.
| Compound Name | 4-[3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]-3-propan-2-ylpiperazin-2-one |
|---|---|
| PubChem CID | 72687206 |
| Molecular Formula | C21H25N3O3S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | 4-[3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoyl]-3-propan-2-ylpiperazin-2-one |
| SMILES | Cc1nc(COc2ccccc2C=CC(=O)N2CCNC(=O)C2C(C)C)cs1 |
| InChI | InChI=1S/C21H25N3O3S/c1-14(2)20-21(26)22-10-11-24(20)19(25)9-8-16-6-4-5-7-18(16)27-12-17-13-28-15(3)23-17/h4-9,13-14,20H,10-12H2,1-3H3,(H,22,26) |
| InChIKey | YPYFEQZMZQWHGN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|