C24H24ClN3O2S — CID 26014762
(E)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-en-1-one (PubChem CID 26014762) has the molecular formula C24H24ClN3O2S and a molecular weight of 454.00 g/mol. Its IUPAC name is (E)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 26014762 |
| Molecular Formula | C24H24ClN3O2S |
| Molecular Weight | 454.00 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | (E)-1-[4-(2-chlorophenyl)piperazin-1-yl]-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-en-1-one |
| SMILES | Cc1nc(COc2ccccc2/C=C/C(=O)N2CCN(c3ccccc3Cl)CC2)cs1 |
| InChI | InChI=1S/C24H24ClN3O2S/c1-18-26-20(17-31-18)16-30-23-9-5-2-6-19(23)10-11-24(29)28-14-12-27(13-15-28)22-8-4-3-7-21(22)25/h2-11,17H,12-16H2,1H3/b11-10+ |
| InChIKey | KPEXPGPHLUQHSQ-ZHACJKMWSA-N |
| XLogP | 5.05 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.00 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|