C20H16N2O5S — CID 43038610
(4-nitrophenyl) (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoate (PubChem CID 43038610) has the molecular formula C20H16N2O5S and a molecular weight of 396.42 g/mol. Its IUPAC name is (4-nitrophenyl) (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoate.
| Compound Name | (4-nitrophenyl) (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 43038610 |
| Molecular Formula | C20H16N2O5S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | (4-nitrophenyl) (E)-3-[2-[(2-methyl-1,3-thiazol-4-yl)methoxy]phenyl]prop-2-enoate |
| SMILES | Cc1nc(COc2ccccc2/C=C/C(=O)Oc2ccc([N+](=O)[O-])cc2)cs1 |
| InChI | InChI=1S/C20H16N2O5S/c1-14-21-16(13-28-14)12-26-19-5-3-2-4-15(19)6-11-20(23)27-18-9-7-17(8-10-18)22(24)25/h2-11,13H,12H2,1H3/b11-6+ |
| InChIKey | ITELXCMZAZWFSX-IZZDOVSWSA-N |
| XLogP | 4.56 |
| TPSA | 91.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|