C20H20ClNO3S — CID 2024027
(E)-N-[(4-chlorophenyl)methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-3-phenylprop-2-enamide (PubChem CID 2024027) has the molecular formula C20H20ClNO3S and a molecular weight of 389.90 g/mol. Its IUPAC name is (E)-N-[(4-chlorophenyl)methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(4-chlorophenyl)methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 2024027 |
| Molecular Formula | C20H20ClNO3S |
| Molecular Weight | 389.90 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | (E)-N-[(4-chlorophenyl)methyl]-N-[(3R)-1,1-dioxothiolan-3-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N(Cc1ccc(Cl)cc1)[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H20ClNO3S/c21-18-9-6-17(7-10-18)14-22(19-12-13-26(24,25)15-19)20(23)11-8-16-4-2-1-3-5-16/h1-11,19H,12-15H2/b11-8+/t19-/m1/s1 |
| InChIKey | LQOFQKCPXUXHBT-UFUQCMIWSA-N |
| XLogP | 3.57 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.90 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|