C22H23Cl2NO3S — CID 6579263
(E)-3-(2,4-dichlorophenyl)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-[(4-ethylphenyl)methyl]prop-2-enamide (PubChem CID 6579263) has the molecular formula C22H23Cl2NO3S and a molecular weight of 452.40 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-[(4-ethylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-[(4-ethylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 6579263 |
| Molecular Formula | C22H23Cl2NO3S |
| Molecular Weight | 452.40 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[(3S)-1,1-dioxothiolan-3-yl]-N-[(4-ethylphenyl)methyl]prop-2-enamide |
| SMILES | CCc1ccc(CN(C(=O)/C=C/c2ccc(Cl)cc2Cl)[C@H]2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C22H23Cl2NO3S/c1-2-16-3-5-17(6-4-16)14-25(20-11-12-29(27,28)15-20)22(26)10-8-18-7-9-19(23)13-21(18)24/h3-10,13,20H,2,11-12,14-15H2,1H3/b10-8+/t20-/m0/s1 |
| InChIKey | YLTDFSZPBZBNCG-MFUYTVRRSA-N |
| XLogP | 4.78 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|