C31H31N3O3S — CID 3370950
N-(1,1-dioxothiolan-3-yl)-3-(1,3-diphenylpyrazol-4-yl)-N-[(4-ethylphenyl)methyl]prop-2-enamide (PubChem CID 3370950) has the molecular formula C31H31N3O3S and a molecular weight of 525.67 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-(1,3-diphenylpyrazol-4-yl)-N-[(4-ethylphenyl)methyl]prop-2-enamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-(1,3-diphenylpyrazol-4-yl)-N-[(4-ethylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 3370950 |
| Molecular Formula | C31H31N3O3S |
| Molecular Weight | 525.67 g/mol |
| Exact Mass | 525.21 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-(1,3-diphenylpyrazol-4-yl)-N-[(4-ethylphenyl)methyl]prop-2-enamide |
| SMILES | CCc1ccc(CN(C(=O)C=Cc2cn(-c3ccccc3)nc2-c2ccccc2)C2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C31H31N3O3S/c1-2-24-13-15-25(16-14-24)21-33(29-19-20-38(36,37)23-29)30(35)18-17-27-22-34(28-11-7-4-8-12-28)32-31(27)26-9-5-3-6-10-26/h3-18,22,29H,2,19-21,23H2,1H3 |
| InChIKey | MAWOORUUGDHQGX-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.67 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|