C29H27N3O7S — CID 4621427
[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 4621427) has the molecular formula C29H27N3O7S and a molecular weight of 561.62 g/mol. Its IUPAC name is [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 4621427 |
| Molecular Formula | C29H27N3O7S |
| Molecular Weight | 561.62 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | [2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl] 3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | CCN(C(=O)COC(=O)C=Cc1cn(-c2ccccc2)nc1-c1cc2ccccc2oc1=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C29H27N3O7S/c1-2-31(23-14-15-40(36,37)19-23)26(33)18-38-27(34)13-12-21-17-32(22-9-4-3-5-10-22)30-28(21)24-16-20-8-6-7-11-25(20)39-29(24)35/h3-13,16-17,23H,2,14-15,18-19H2,1H3 |
| InChIKey | RWEDWRADADPCIR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 128.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.62 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|