C29H23N3O4 — CID 3896705
[2-(N-methylanilino)-2-oxoethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 3896705) has the molecular formula C29H23N3O4 and a molecular weight of 477.52 g/mol. Its IUPAC name is [2-(N-methylanilino)-2-oxoethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(N-methylanilino)-2-oxoethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 3896705 |
| Molecular Formula | C29H23N3O4 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | [2-(N-methylanilino)-2-oxoethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | CN(C(=O)COC(=O)C=Cc1cn(-c2ccccc2)nc1-c1cc2ccccc2o1)c1ccccc1 |
| InChI | InChI=1S/C29H23N3O4/c1-31(23-11-4-2-5-12-23)27(33)20-35-28(34)17-16-22-19-32(24-13-6-3-7-14-24)30-29(22)26-18-21-10-8-9-15-25(21)36-26/h2-19H,20H2,1H3 |
| InChIKey | PEIAJENFGKISCV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|