C27H19ClN4O4 — CID 71953788
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 71953788) has the molecular formula C27H19ClN4O4 and a molecular weight of 498.93 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 71953788 |
| Molecular Formula | C27H19ClN4O4 |
| Molecular Weight | 498.93 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1cn(-c2ccccc2)nc1-c1cc2ccccc2o1)Nc1cccnc1Cl |
| InChI | InChI=1S/C27H19ClN4O4/c28-27-21(10-6-14-29-27)30-24(33)17-35-25(34)13-12-19-16-32(20-8-2-1-3-9-20)31-26(19)23-15-18-7-4-5-11-22(18)36-23/h1-16H,17H2,(H,30,33) |
| InChIKey | FRNJIQUDJFSRNZ-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 99.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.93 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|