C32H25N3O7 — CID 4998362
ethyl 2-[[2-[3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoyloxy]acetyl]amino]benzoate (PubChem CID 4998362) has the molecular formula C32H25N3O7 and a molecular weight of 563.57 g/mol. Its IUPAC name is ethyl 2-[[2-[3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoyloxy]acetyl]amino]benzoate.
| Compound Name | ethyl 2-[[2-[3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoyloxy]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 4998362 |
| Molecular Formula | C32H25N3O7 |
| Molecular Weight | 563.57 g/mol |
| Exact Mass | 563.17 |
| IUPAC Name | ethyl 2-[[2-[3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoyloxy]acetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)COC(=O)C=Cc1cn(-c2ccccc2)nc1-c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C32H25N3O7/c1-2-40-31(38)24-13-7-8-14-26(24)33-28(36)20-41-29(37)17-16-22-19-35(23-11-4-3-5-12-23)34-30(22)25-18-21-10-6-9-15-27(21)42-32(25)39/h3-19H,2,20H2,1H3,(H,33,36) |
| InChIKey | QFOGLJZVQIHPMS-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 129.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|