C29H19N3O4S — CID 3505863
1,3-benzothiazol-2-ylmethyl 3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 3505863) has the molecular formula C29H19N3O4S and a molecular weight of 505.56 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl 3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | 1,3-benzothiazol-2-ylmethyl 3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 3505863 |
| Molecular Formula | C29H19N3O4S |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.11 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl 3-[3-(2-oxochromen-3-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | O=C(C=Cc1cn(-c2ccccc2)nc1-c1cc2ccccc2oc1=O)OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C29H19N3O4S/c33-27(35-18-26-30-23-11-5-7-13-25(23)37-26)15-14-20-17-32(21-9-2-1-3-10-21)31-28(20)22-16-19-8-4-6-12-24(19)36-29(22)34/h1-17H,18H2 |
| InChIKey | ISCUCZWJRUGOBG-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 87.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|