C27H21N3O4S — CID 5026232
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 5026232) has the molecular formula C27H21N3O4S and a molecular weight of 483.55 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 5026232 |
| Molecular Formula | C27H21N3O4S |
| Molecular Weight | 483.55 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1cn(-c2ccccc2)nc1-c1cc2ccccc2o1)NCc1cccs1 |
| InChI | InChI=1S/C27H21N3O4S/c31-25(28-16-22-10-6-14-35-22)18-33-26(32)13-12-20-17-30(21-8-2-1-3-9-21)29-27(20)24-15-19-7-4-5-11-23(19)34-24/h1-15,17H,16,18H2,(H,28,31) |
| InChIKey | CIIZPNRWCIZSHA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.55 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|