C30H23N3O4 — CID 2402048
[2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 2402048) has the molecular formula C30H23N3O4 and a molecular weight of 489.53 g/mol. Its IUPAC name is [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2402048 |
| Molecular Formula | C30H23N3O4 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | [2-(2,3-dihydroindol-1-yl)-2-oxoethyl] (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1cc2ccccc2o1)OCC(=O)N1CCc2ccccc21 |
| InChI | InChI=1S/C30H23N3O4/c34-28(32-17-16-21-8-4-6-12-25(21)32)20-36-29(35)15-14-23-19-33(24-10-2-1-3-11-24)31-30(23)27-18-22-9-5-7-13-26(22)37-27/h1-15,18-19H,16-17,20H2/b15-14+ |
| InChIKey | IXPDIZZXHHKIKR-CCEZHUSRSA-N |
| XLogP | 5.43 |
| TPSA | 77.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|