C31H21N5O4 — CID 2416161
[3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 2416161) has the molecular formula C31H21N5O4 and a molecular weight of 527.54 g/mol. Its IUPAC name is [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2416161 |
| Molecular Formula | C31H21N5O4 |
| Molecular Weight | 527.54 g/mol |
| Exact Mass | 527.16 |
| IUPAC Name | [3-(1H-benzimidazol-2-yl)-3-cyano-2-hydroxyprop-2-enyl] (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | N#CC(=C(O)COC(=O)/C=C/c1cn(-c2ccccc2)nc1-c1cc2ccccc2o1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C31H21N5O4/c32-17-23(31-33-24-11-5-6-12-25(24)34-31)26(37)19-39-29(38)15-14-21-18-36(22-9-2-1-3-10-22)35-30(21)28-16-20-8-4-7-13-27(20)40-28/h1-16,18,37H,19H2,(H,33,34)/b15-14+,26-23? |
| InChIKey | ILWIHQKRFMDZNJ-VAWXRNAASA-N |
| XLogP | 6.21 |
| TPSA | 129.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.54 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|