C30H21N3O4 — CID 5028024
[2-(1H-indol-3-yl)-2-oxoethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 5028024) has the molecular formula C30H21N3O4 and a molecular weight of 487.52 g/mol. Its IUPAC name is [2-(1H-indol-3-yl)-2-oxoethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-(1H-indol-3-yl)-2-oxoethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 5028024 |
| Molecular Formula | C30H21N3O4 |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | [2-(1H-indol-3-yl)-2-oxoethyl] 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | O=C(C=Cc1cn(-c2ccccc2)nc1-c1cc2ccccc2o1)OCC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C30H21N3O4/c34-26(24-17-31-25-12-6-5-11-23(24)25)19-36-29(35)15-14-21-18-33(22-9-2-1-3-10-22)32-30(21)28-16-20-8-4-7-13-27(20)37-28/h1-18,31H,19H2 |
| InChIKey | ROJCKRUCIZKGIS-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|