C29H21F2N3O4S — CID 2493389
[2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate (PubChem CID 2493389) has the molecular formula C29H21F2N3O4S and a molecular weight of 545.57 g/mol. Its IUPAC name is [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate.
| Compound Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 2493389 |
| Molecular Formula | C29H21F2N3O4S |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | [2-[4-(difluoromethylsulfanyl)anilino]-2-oxoethyl] (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1cn(-c2ccccc2)nc1-c1cc2ccccc2o1)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C29H21F2N3O4S/c30-29(31)39-23-13-11-21(12-14-23)32-26(35)18-37-27(36)15-10-20-17-34(22-7-2-1-3-8-22)33-28(20)25-16-19-6-4-5-9-24(19)38-25/h1-17,29H,18H2,(H,32,35)/b15-10+ |
| InChIKey | UIDKNSGWBYVYJG-XNTDXEJSSA-N |
| XLogP | 6.80 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|