C25H25N4O2+ — CID 2371386
(E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-1-(4-methylpiperazin-4-ium-1-yl)prop-2-en-1-one (PubChem CID 2371386) has the molecular formula C25H25N4O2+ and a molecular weight of 413.50 g/mol. Its IUPAC name is (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-1-(4-methylpiperazin-4-ium-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-1-(4-methylpiperazin-4-ium-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 2371386 |
| Molecular Formula | C25H25N4O2+ |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-1-(4-methylpiperazin-4-ium-1-yl)prop-2-en-1-one |
| SMILES | C[NH+]1CCN(C(=O)/C=C/c2cn(-c3ccccc3)nc2-c2cc3ccccc3o2)CC1 |
| InChI | InChI=1S/C25H24N4O2/c1-27-13-15-28(16-14-27)24(30)12-11-20-18-29(21-8-3-2-4-9-21)26-25(20)23-17-19-7-5-6-10-22(19)31-23/h2-12,17-18H,13-16H2,1H3/p+1/b12-11+ |
| InChIKey | WNXCBRDXPBVDOT-VAWYXSNFSA-O |
| XLogP | 2.66 |
| TPSA | 55.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|