C28H23N3O4S — CID 60553676
(E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-[(4-methylsulfonylphenyl)methyl]prop-2-enamide (PubChem CID 60553676) has the molecular formula C28H23N3O4S and a molecular weight of 497.58 g/mol. Its IUPAC name is (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-[(4-methylsulfonylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-[(4-methylsulfonylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 60553676 |
| Molecular Formula | C28H23N3O4S |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.14 |
| IUPAC Name | (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-[(4-methylsulfonylphenyl)methyl]prop-2-enamide |
| SMILES | CS(=O)(=O)c1ccc(CNC(=O)/C=C/c2cn(-c3ccccc3)nc2-c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C28H23N3O4S/c1-36(33,34)24-14-11-20(12-15-24)18-29-27(32)16-13-22-19-31(23-8-3-2-4-9-23)30-28(22)26-17-21-7-5-6-10-25(21)35-26/h2-17,19H,18H2,1H3,(H,29,32)/b16-13+ |
| InChIKey | YRMDVAVWNCZDNO-DTQAZKPQSA-N |
| XLogP | 5.02 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|