C27H20N2O3 — CID 3936192
3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-1-(3-methoxyphenyl)prop-2-en-1-one (PubChem CID 3936192) has the molecular formula C27H20N2O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-1-(3-methoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-1-(3-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3936192 |
| Molecular Formula | C27H20N2O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-1-(3-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cccc(C(=O)C=Cc2cn(-c3ccccc3)nc2-c2cc3ccccc3o2)c1 |
| InChI | InChI=1S/C27H20N2O3/c1-31-23-12-7-9-19(16-23)24(30)15-14-21-18-29(22-10-3-2-4-11-22)28-27(21)26-17-20-8-5-6-13-25(20)32-26/h2-18H,1H3 |
| InChIKey | RIOJLWWYBQNLAT-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|