C27H27N3O2 — CID 2123513
(Z)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-cyclohexyl-N-methylprop-2-enamide (PubChem CID 2123513) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is (Z)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-cyclohexyl-N-methylprop-2-enamide.
| Compound Name | (Z)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-cyclohexyl-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 2123513 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | (Z)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-N-cyclohexyl-N-methylprop-2-enamide |
| SMILES | CN(C(=O)/C=C\c1cn(-c2ccccc2)nc1-c1cc2ccccc2o1)C1CCCCC1 |
| InChI | InChI=1S/C27H27N3O2/c1-29(22-11-4-2-5-12-22)26(31)17-16-21-19-30(23-13-6-3-7-14-23)28-27(21)25-18-20-10-8-9-15-24(20)32-25/h3,6-10,13-19,22H,2,4-5,11-12H2,1H3/b17-16- |
| InChIKey | ATHDKIRCOCZWJP-MSUUIHNZSA-N |
| XLogP | 6.09 |
| TPSA | 51.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|