C30H25N3O3 — CID 6297755
(E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one (PubChem CID 6297755) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6297755 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | (E)-3-[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]-1-(4-morpholin-4-ylphenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cn(-c2ccccc2)nc1-c1cc2ccccc2o1)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C30H25N3O3/c34-27(22-10-13-25(14-11-22)32-16-18-35-19-17-32)15-12-24-21-33(26-7-2-1-3-8-26)31-30(24)29-20-23-6-4-5-9-28(23)36-29/h1-15,20-21H,16-19H2/b15-12+ |
| InChIKey | UAVNHLCOKWJRDF-NTCAYCPXSA-N |
| XLogP | 6.02 |
| TPSA | 60.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|