C25H16N3O3- — CID 2360662
4-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzoate (PubChem CID 2360662) has the molecular formula C25H16N3O3- and a molecular weight of 406.42 g/mol. Its IUPAC name is 4-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzoate.
| Compound Name | 4-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzoate |
|---|---|
| PubChem CID | 2360662 |
| Molecular Formula | C25H16N3O3- |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 4-[[3-(1-benzofuran-2-yl)-1-phenylpyrazol-4-yl]methylideneamino]benzoate |
| SMILES | O=C([O-])c1ccc(/N=C/c2cn(-c3ccccc3)nc2-c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C25H17N3O3/c29-25(30)17-10-12-20(13-11-17)26-15-19-16-28(21-7-2-1-3-8-21)27-24(19)23-14-18-6-4-5-9-22(18)31-23/h1-16H,(H,29,30)/p-1/b26-15+ |
| InChIKey | DSWWYZJHQKVTHP-CVKSISIWSA-M |
| XLogP | 4.40 |
| TPSA | 83.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|