C27H18N4O5 — CID 2337293
4-[[3-[5-(4-nitrophenyl)furan-2-yl]-1-phenylpyrazol-4-yl]methylideneamino]benzoic acid (PubChem CID 2337293) has the molecular formula C27H18N4O5 and a molecular weight of 478.46 g/mol. Its IUPAC name is 4-[[3-[5-(4-nitrophenyl)furan-2-yl]-1-phenylpyrazol-4-yl]methylideneamino]benzoic acid.
| Compound Name | 4-[[3-[5-(4-nitrophenyl)furan-2-yl]-1-phenylpyrazol-4-yl]methylideneamino]benzoic acid |
|---|---|
| PubChem CID | 2337293 |
| Molecular Formula | C27H18N4O5 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 4-[[3-[5-(4-nitrophenyl)furan-2-yl]-1-phenylpyrazol-4-yl]methylideneamino]benzoic acid |
| SMILES | O=C(O)c1ccc(/N=C/c2cn(-c3ccccc3)nc2-c2ccc(-c3ccc([N+](=O)[O-])cc3)o2)cc1 |
| InChI | InChI=1S/C27H18N4O5/c32-27(33)19-6-10-21(11-7-19)28-16-20-17-30(22-4-2-1-3-5-22)29-26(20)25-15-14-24(36-25)18-8-12-23(13-9-18)31(34)35/h1-17H,(H,32,33)/b28-16+ |
| InChIKey | XRRDMTGWQVYJFZ-LQKURTRISA-N |
| XLogP | 6.16 |
| TPSA | 123.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|