C19H13N5O3S2 — CID 123614397
4-hydroxy-3-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,3-thiazole-2-thione (PubChem CID 123614397) has the molecular formula C19H13N5O3S2 and a molecular weight of 423.48 g/mol. Its IUPAC name is 4-hydroxy-3-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,3-thiazole-2-thione.
| Compound Name | 4-hydroxy-3-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 123614397 |
| Molecular Formula | C19H13N5O3S2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.05 |
| IUPAC Name | 4-hydroxy-3-[[3-(4-nitrophenyl)-1-phenylpyrazol-4-yl]methylideneamino]-1,3-thiazole-2-thione |
| SMILES | O=[N+]([O-])c1ccc(-c2nn(-c3ccccc3)cc2C=Nn2c(O)csc2=S)cc1 |
| InChI | InChI=1S/C19H13N5O3S2/c25-17-12-29-19(28)23(17)20-10-14-11-22(15-4-2-1-3-5-15)21-18(14)13-6-8-16(9-7-13)24(26)27/h1-12,25H |
| InChIKey | XDQSGJLJXGVZRI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|