C29H18N8O3 — CID 71602916
2-amino-1-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-4-(2-nitrophenyl)-6-oxopyridine-3,5-dicarbonitrile (PubChem CID 71602916) has the molecular formula C29H18N8O3 and a molecular weight of 526.52 g/mol. Its IUPAC name is 2-amino-1-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-4-(2-nitrophenyl)-6-oxopyridine-3,5-dicarbonitrile.
| Compound Name | 2-amino-1-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-4-(2-nitrophenyl)-6-oxopyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 71602916 |
| Molecular Formula | C29H18N8O3 |
| Molecular Weight | 526.52 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | 2-amino-1-[(E)-(1,3-diphenylpyrazol-4-yl)methylideneamino]-4-(2-nitrophenyl)-6-oxopyridine-3,5-dicarbonitrile |
| SMILES | N#Cc1c(-c2ccccc2[N+](=O)[O-])c(C#N)c(=O)n(/N=C/c2cn(-c3ccccc3)nc2-c2ccccc2)c1N |
| InChI | InChI=1S/C29H18N8O3/c30-15-23-26(22-13-7-8-14-25(22)37(39)40)24(16-31)29(38)36(28(23)32)33-17-20-18-35(21-11-5-2-6-12-21)34-27(20)19-9-3-1-4-10-19/h1-14,17-18H,32H2/b33-17+ |
| InChIKey | QVJMPINRONABSP-ATZGPIRCSA-N |
| XLogP | 4.48 |
| TPSA | 168.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|