C28H19N7 — CID 4704577
5-amino-3-[1-cyano-2-(1,3-diphenylpyrazol-4-yl)ethenyl]-1-phenylpyrazole-4-carbonitrile (PubChem CID 4704577) has the molecular formula C28H19N7 and a molecular weight of 453.51 g/mol. Its IUPAC name is 5-amino-3-[1-cyano-2-(1,3-diphenylpyrazol-4-yl)ethenyl]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[1-cyano-2-(1,3-diphenylpyrazol-4-yl)ethenyl]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 4704577 |
| Molecular Formula | C28H19N7 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | 5-amino-3-[1-cyano-2-(1,3-diphenylpyrazol-4-yl)ethenyl]-1-phenylpyrazole-4-carbonitrile |
| SMILES | N#CC(=Cc1cn(-c2ccccc2)nc1-c1ccccc1)c1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C28H19N7/c29-17-21(27-25(18-30)28(31)35(33-27)24-14-8-3-9-15-24)16-22-19-34(23-12-6-2-7-13-23)32-26(22)20-10-4-1-5-11-20/h1-16,19H,31H2 |
| InChIKey | VFXRJNBQGQUKCM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|