C19H12FN5 — CID 2851488
5-amino-3-[1-cyano-2-(2-fluorophenyl)ethenyl]-1-phenylpyrazole-4-carbonitrile (PubChem CID 2851488) has the molecular formula C19H12FN5 and a molecular weight of 329.34 g/mol. Its IUPAC name is 5-amino-3-[1-cyano-2-(2-fluorophenyl)ethenyl]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[1-cyano-2-(2-fluorophenyl)ethenyl]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 2851488 |
| Molecular Formula | C19H12FN5 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 5-amino-3-[1-cyano-2-(2-fluorophenyl)ethenyl]-1-phenylpyrazole-4-carbonitrile |
| SMILES | N#CC(=Cc1ccccc1F)c1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C19H12FN5/c20-17-9-5-4-6-13(17)10-14(11-21)18-16(12-22)19(23)25(24-18)15-7-2-1-3-8-15/h1-10H,23H2 |
| InChIKey | WDMOHQDEGKYVHD-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|