C28H19ClN6 — CID 5286804
5-amino-3-[(Z)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile (PubChem CID 5286804) has the molecular formula C28H19ClN6 and a molecular weight of 474.96 g/mol. Its IUPAC name is 5-amino-3-[(Z)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[(Z)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 5286804 |
| Molecular Formula | C28H19ClN6 |
| Molecular Weight | 474.96 g/mol |
| Exact Mass | 474.14 |
| IUPAC Name | 5-amino-3-[(Z)-2-[1-[(4-chlorophenyl)methyl]indol-3-yl]-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile |
| SMILES | N#C/C(=C\c1cn(Cc2ccc(Cl)cc2)c2ccccc12)c1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C28H19ClN6/c29-22-12-10-19(11-13-22)17-34-18-21(24-8-4-5-9-26(24)34)14-20(15-30)27-25(16-31)28(32)35(33-27)23-6-2-1-3-7-23/h1-14,18H,17,32H2/b20-14+ |
| InChIKey | FFZNXQBESJLVLS-XSFVSMFZSA-N |
| XLogP | 6.05 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.96 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|