C28H18Cl2N6 — CID 92908200
5-amino-3-[(E)-1-cyano-2-[3-[(2,4-dichlorophenyl)methyl]indol-1-yl]ethenyl]-1-phenylpyrazole-4-carbonitrile (PubChem CID 92908200) has the molecular formula C28H18Cl2N6 and a molecular weight of 509.40 g/mol. Its IUPAC name is 5-amino-3-[(E)-1-cyano-2-[3-[(2,4-dichlorophenyl)methyl]indol-1-yl]ethenyl]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[(E)-1-cyano-2-[3-[(2,4-dichlorophenyl)methyl]indol-1-yl]ethenyl]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 92908200 |
| Molecular Formula | C28H18Cl2N6 |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 5-amino-3-[(E)-1-cyano-2-[3-[(2,4-dichlorophenyl)methyl]indol-1-yl]ethenyl]-1-phenylpyrazole-4-carbonitrile |
| SMILES | N#C/C(=C/n1cc(Cc2ccc(Cl)cc2Cl)c2ccccc21)c1nn(-c2ccccc2)c(N)c1C#N |
| InChI | InChI=1S/C28H18Cl2N6/c29-21-11-10-18(25(30)13-21)12-19-16-35(26-9-5-4-8-23(19)26)17-20(14-31)27-24(15-32)28(33)36(34-27)22-6-2-1-3-7-22/h1-11,13,16-17H,12,33H2/b20-17- |
| InChIKey | RWEVKHXGFHTZOW-JZJYNLBNSA-N |
| XLogP | 6.70 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|