C21H16BrN5O2 — CID 5286780
5-amino-3-[(Z)-2-(3-bromo-4,5-dimethoxyphenyl)-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile (PubChem CID 5286780) has the molecular formula C21H16BrN5O2 and a molecular weight of 450.30 g/mol. Its IUPAC name is 5-amino-3-[(Z)-2-(3-bromo-4,5-dimethoxyphenyl)-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[(Z)-2-(3-bromo-4,5-dimethoxyphenyl)-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 5286780 |
| Molecular Formula | C21H16BrN5O2 |
| Molecular Weight | 450.30 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | 5-amino-3-[(Z)-2-(3-bromo-4,5-dimethoxyphenyl)-1-cyanoethenyl]-1-phenylpyrazole-4-carbonitrile |
| SMILES | COc1cc(/C=C(\C#N)c2nn(-c3ccccc3)c(N)c2C#N)cc(Br)c1OC |
| InChI | InChI=1S/C21H16BrN5O2/c1-28-18-10-13(9-17(22)20(18)29-2)8-14(11-23)19-16(12-24)21(25)27(26-19)15-6-4-3-5-7-15/h3-10H,25H2,1-2H3/b14-8+ |
| InChIKey | WCRURFAJRXGFJN-RIYZIHGNSA-N |
| XLogP | 4.17 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|