C28H20N6O2 — CID 73449617
5-amino-3-[1-cyano-2-[4-[(4-cyanophenyl)methoxy]-3-methoxyphenyl]ethenyl]-1-phenylpyrazole-4-carbonitrile (PubChem CID 73449617) has the molecular formula C28H20N6O2 and a molecular weight of 472.51 g/mol. Its IUPAC name is 5-amino-3-[1-cyano-2-[4-[(4-cyanophenyl)methoxy]-3-methoxyphenyl]ethenyl]-1-phenylpyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[1-cyano-2-[4-[(4-cyanophenyl)methoxy]-3-methoxyphenyl]ethenyl]-1-phenylpyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 73449617 |
| Molecular Formula | C28H20N6O2 |
| Molecular Weight | 472.51 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 5-amino-3-[1-cyano-2-[4-[(4-cyanophenyl)methoxy]-3-methoxyphenyl]ethenyl]-1-phenylpyrazole-4-carbonitrile |
| SMILES | COc1cc(C=C(C#N)c2nn(-c3ccccc3)c(N)c2C#N)ccc1OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C28H20N6O2/c1-35-26-14-21(11-12-25(26)36-18-20-9-7-19(15-29)8-10-20)13-22(16-30)27-24(17-31)28(32)34(33-27)23-5-3-2-4-6-23/h2-14H,18,32H2,1H3 |
| InChIKey | NUFCIHRTPQQWBQ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 133.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|