C18H19N5O3 — CID 5287378
5-amino-3-[(Z)-1-cyano-2-(4-ethoxy-3-methoxyphenyl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile (PubChem CID 5287378) has the molecular formula C18H19N5O3 and a molecular weight of 353.38 g/mol. Its IUPAC name is 5-amino-3-[(Z)-1-cyano-2-(4-ethoxy-3-methoxyphenyl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[(Z)-1-cyano-2-(4-ethoxy-3-methoxyphenyl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 5287378 |
| Molecular Formula | C18H19N5O3 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 5-amino-3-[(Z)-1-cyano-2-(4-ethoxy-3-methoxyphenyl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile |
| SMILES | CCOc1ccc(/C=C(\C#N)c2nn(CCO)c(N)c2C#N)cc1OC |
| InChI | InChI=1S/C18H19N5O3/c1-3-26-15-5-4-12(9-16(15)25-2)8-13(10-19)17-14(11-20)18(21)23(22-17)6-7-24/h4-5,8-9,24H,3,6-7,21H2,1-2H3/b13-8+ |
| InChIKey | HAAYDEZBBHNLPL-MDWZMJQESA-N |
| XLogP | 1.80 |
| TPSA | 130.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|