C18H18IN5O3 — CID 3111511
5-amino-3-[1-cyano-2-(4-ethoxy-3-iodo-5-methoxyphenyl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile (PubChem CID 3111511) has the molecular formula C18H18IN5O3 and a molecular weight of 479.28 g/mol. Its IUPAC name is 5-amino-3-[1-cyano-2-(4-ethoxy-3-iodo-5-methoxyphenyl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile.
| Compound Name | 5-amino-3-[1-cyano-2-(4-ethoxy-3-iodo-5-methoxyphenyl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 3111511 |
| Molecular Formula | C18H18IN5O3 |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 5-amino-3-[1-cyano-2-(4-ethoxy-3-iodo-5-methoxyphenyl)ethenyl]-1-(2-hydroxyethyl)pyrazole-4-carbonitrile |
| SMILES | CCOc1c(I)cc(C=C(C#N)c2nn(CCO)c(N)c2C#N)cc1OC |
| InChI | InChI=1S/C18H18IN5O3/c1-3-27-17-14(19)7-11(8-15(17)26-2)6-12(9-20)16-13(10-21)18(22)24(23-16)4-5-25/h6-8,25H,3-5,22H2,1-2H3 |
| InChIKey | MLDSNQFWJQNKBZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 130.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|