C18H14N6O2 — CID 3147806
2,4-diamino-6-[1-cyano-2-(3,4-dimethoxyphenyl)ethenyl]pyridine-3,5-dicarbonitrile (PubChem CID 3147806) has the molecular formula C18H14N6O2 and a molecular weight of 346.35 g/mol. Its IUPAC name is 2,4-diamino-6-[1-cyano-2-(3,4-dimethoxyphenyl)ethenyl]pyridine-3,5-dicarbonitrile.
| Compound Name | 2,4-diamino-6-[1-cyano-2-(3,4-dimethoxyphenyl)ethenyl]pyridine-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 3147806 |
| Molecular Formula | C18H14N6O2 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2,4-diamino-6-[1-cyano-2-(3,4-dimethoxyphenyl)ethenyl]pyridine-3,5-dicarbonitrile |
| SMILES | COc1ccc(C=C(C#N)c2nc(N)c(C#N)c(N)c2C#N)cc1OC |
| InChI | InChI=1S/C18H14N6O2/c1-25-14-4-3-10(6-15(14)26-2)5-11(7-19)17-12(8-20)16(22)13(9-21)18(23)24-17/h3-6H,1-2H3,(H4,22,23,24) |
| InChIKey | XWGCOLPTOQNKCH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 154.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|