C19H15NO3 — CID 67228333
(Z)-2-(2-benzofuran-1-yl)-3-(3,4-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 67228333) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is (Z)-2-(2-benzofuran-1-yl)-3-(3,4-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (Z)-2-(2-benzofuran-1-yl)-3-(3,4-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 67228333 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (Z)-2-(2-benzofuran-1-yl)-3-(3,4-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1ccc(/C=C(/C#N)c2occ3ccccc23)cc1OC |
| InChI | InChI=1S/C19H15NO3/c1-21-17-8-7-13(10-18(17)22-2)9-15(11-20)19-16-6-4-3-5-14(16)12-23-19/h3-10,12H,1-2H3/b15-9- |
| InChIKey | QMZFSPMJWIQDKS-DHDCSXOGSA-N |
| XLogP | 4.51 |
| TPSA | 55.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|