C24H21NO3 — CID 7126688
(E)-3-[3-methoxy-4-(2-phenoxyethoxy)phenyl]-2-phenylprop-2-enenitrile (PubChem CID 7126688) has the molecular formula C24H21NO3 and a molecular weight of 371.44 g/mol. Its IUPAC name is (E)-3-[3-methoxy-4-(2-phenoxyethoxy)phenyl]-2-phenylprop-2-enenitrile.
| Compound Name | (E)-3-[3-methoxy-4-(2-phenoxyethoxy)phenyl]-2-phenylprop-2-enenitrile |
|---|---|
| PubChem CID | 7126688 |
| Molecular Formula | C24H21NO3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (E)-3-[3-methoxy-4-(2-phenoxyethoxy)phenyl]-2-phenylprop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)c2ccccc2)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C24H21NO3/c1-26-24-17-19(16-21(18-25)20-8-4-2-5-9-20)12-13-23(24)28-15-14-27-22-10-6-3-7-11-22/h2-13,16-17H,14-15H2,1H3/b21-16- |
| InChIKey | KXADLWRCBBBWGB-PGMHBOJBSA-N |
| XLogP | 5.22 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|