C19H18N2O4 — CID 3518624
2-cyano-3-[3-methoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enamide (PubChem CID 3518624) has the molecular formula C19H18N2O4 and a molecular weight of 338.36 g/mol. Its IUPAC name is 2-cyano-3-[3-methoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enamide.
| Compound Name | 2-cyano-3-[3-methoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3518624 |
| Molecular Formula | C19H18N2O4 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 2-cyano-3-[3-methoxy-4-(2-phenoxyethoxy)phenyl]prop-2-enamide |
| SMILES | COc1cc(C=C(C#N)C(N)=O)ccc1OCCOc1ccccc1 |
| InChI | InChI=1S/C19H18N2O4/c1-23-18-12-14(11-15(13-20)19(21)22)7-8-17(18)25-10-9-24-16-5-3-2-4-6-16/h2-8,11-12H,9-10H2,1H3,(H2,21,22) |
| InChIKey | FRANPNXPGXZNQY-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|