C27H25NO5 — CID 39114322
[4-[(E)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 4-(4-methoxyphenoxy)butanoate (PubChem CID 39114322) has the molecular formula C27H25NO5 and a molecular weight of 443.50 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 4-(4-methoxyphenoxy)butanoate.
| Compound Name | [4-[(E)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 4-(4-methoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 39114322 |
| Molecular Formula | C27H25NO5 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | [4-[(E)-2-cyano-2-phenylethenyl]-2-methoxyphenyl] 4-(4-methoxyphenoxy)butanoate |
| SMILES | COc1ccc(OCCCC(=O)Oc2ccc(/C=C(/C#N)c3ccccc3)cc2OC)cc1 |
| InChI | InChI=1S/C27H25NO5/c1-30-23-11-13-24(14-12-23)32-16-6-9-27(29)33-25-15-10-20(18-26(25)31-2)17-22(19-28)21-7-4-3-5-8-21/h3-5,7-8,10-15,17-18H,6,9,16H2,1-2H3/b22-17- |
| InChIKey | RSXBTPQSWGOKRT-XLNRJJMWSA-N |
| XLogP | 5.53 |
| TPSA | 77.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|