C27H25NO4 — CID 39114719
[4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-(4-methylphenyl)propanoate (PubChem CID 39114719) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-(4-methylphenyl)propanoate.
| Compound Name | [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 39114719 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | [4-[(E)-2-cyano-2-(4-methoxyphenyl)ethenyl]-2-methoxyphenyl] 3-(4-methylphenyl)propanoate |
| SMILES | COc1ccc(/C(C#N)=C\c2ccc(OC(=O)CCc3ccc(C)cc3)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H25NO4/c1-19-4-6-20(7-5-19)9-15-27(29)32-25-14-8-21(17-26(25)31-3)16-23(18-28)22-10-12-24(30-2)13-11-22/h4-8,10-14,16-17H,9,15H2,1-3H3/b23-16- |
| InChIKey | ZVGLBTQJSIZOLV-KQWNVCNZSA-N |
| XLogP | 5.61 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|