C19H18N2O3 — CID 955026
2-[4-[(Z)-2-cyano-2-(4-methylphenyl)ethenyl]-2-methoxyphenoxy]acetamide (PubChem CID 955026) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 2-[4-[(Z)-2-cyano-2-(4-methylphenyl)ethenyl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(Z)-2-cyano-2-(4-methylphenyl)ethenyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 955026 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 2-[4-[(Z)-2-cyano-2-(4-methylphenyl)ethenyl]-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(/C=C(\C#N)c2ccc(C)cc2)ccc1OCC(N)=O |
| InChI | InChI=1S/C19H18N2O3/c1-13-3-6-15(7-4-13)16(11-20)9-14-5-8-17(18(10-14)23-2)24-12-19(21)22/h3-10H,12H2,1-2H3,(H2,21,22)/b16-9+ |
| InChIKey | CDULTGROUZIZBY-CXUHLZMHSA-N |
| XLogP | 2.93 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|