C13H11N3O3 — CID 4778390
2-[4-(2,2-dicyanoethenyl)-2-methoxyphenoxy]acetamide (PubChem CID 4778390) has the molecular formula C13H11N3O3 and a molecular weight of 257.25 g/mol. Its IUPAC name is 2-[4-(2,2-dicyanoethenyl)-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-(2,2-dicyanoethenyl)-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 4778390 |
| Molecular Formula | C13H11N3O3 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 2-[4-(2,2-dicyanoethenyl)-2-methoxyphenoxy]acetamide |
| SMILES | COc1cc(C=C(C#N)C#N)ccc1OCC(N)=O |
| InChI | InChI=1S/C13H11N3O3/c1-18-12-5-9(4-10(6-14)7-15)2-3-11(12)19-8-13(16)17/h2-5H,8H2,1H3,(H2,16,17) |
| InChIKey | UOAMDVWPEUQXPO-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 109.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|