C12H16N2O4 — CID 24542213
2-[4-[(E)-ethoxyiminomethyl]-2-methoxyphenoxy]acetamide (PubChem CID 24542213) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is 2-[4-[(E)-ethoxyiminomethyl]-2-methoxyphenoxy]acetamide.
| Compound Name | 2-[4-[(E)-ethoxyiminomethyl]-2-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 24542213 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-[4-[(E)-ethoxyiminomethyl]-2-methoxyphenoxy]acetamide |
| SMILES | CCO/N=C/c1ccc(OCC(N)=O)c(OC)c1 |
| InChI | InChI=1S/C12H16N2O4/c1-3-18-14-7-9-4-5-10(11(6-9)16-2)17-8-12(13)15/h4-7H,3,8H2,1-2H3,(H2,13,15)/b14-7+ |
| InChIKey | LFUGMCZFXOUKMJ-VGOFMYFVSA-N |
| XLogP | 0.93 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|