C16H18N2O2 — CID 49311619
2-[[4-methoxy-3-(3-methylbutoxy)phenyl]methylidene]propanedinitrile (PubChem CID 49311619) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 2-[[4-methoxy-3-(3-methylbutoxy)phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-methoxy-3-(3-methylbutoxy)phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 49311619 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2-[[4-methoxy-3-(3-methylbutoxy)phenyl]methylidene]propanedinitrile |
| SMILES | COc1ccc(C=C(C#N)C#N)cc1OCCC(C)C |
| InChI | InChI=1S/C16H18N2O2/c1-12(2)6-7-20-16-9-13(4-5-15(16)19-3)8-14(10-17)11-18/h4-5,8-9,12H,6-7H2,1-3H3 |
| InChIKey | BENNROCZSLDXIV-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|