C25H20N4O4 — CID 50884372
2-[[4-[[4-(2,2-dicyanoethenyl)-2-ethoxyphenoxy]methoxy]-3-ethoxyphenyl]methylidene]propanedinitrile (PubChem CID 50884372) has the molecular formula C25H20N4O4 and a molecular weight of 440.46 g/mol. Its IUPAC name is 2-[[4-[[4-(2,2-dicyanoethenyl)-2-ethoxyphenoxy]methoxy]-3-ethoxyphenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[[4-(2,2-dicyanoethenyl)-2-ethoxyphenoxy]methoxy]-3-ethoxyphenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 50884372 |
| Molecular Formula | C25H20N4O4 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-[[4-[[4-(2,2-dicyanoethenyl)-2-ethoxyphenoxy]methoxy]-3-ethoxyphenyl]methylidene]propanedinitrile |
| SMILES | CCOc1cc(C=C(C#N)C#N)ccc1OCOc1ccc(C=C(C#N)C#N)cc1OCC |
| InChI | InChI=1S/C25H20N4O4/c1-3-30-24-11-18(9-20(13-26)14-27)5-7-22(24)32-17-33-23-8-6-19(10-21(15-28)16-29)12-25(23)31-4-2/h5-12H,3-4,17H2,1-2H3 |
| InChIKey | MQZDTLVMYGKQIY-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 132.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|