C20H17N5O3S — CID 46258224
2-[[3-ethoxy-4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]methylidene]propanedinitrile (PubChem CID 46258224) has the molecular formula C20H17N5O3S and a molecular weight of 407.46 g/mol. Its IUPAC name is 2-[[3-ethoxy-4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]methylidene]propanedinitrile.
| Compound Name | 2-[[3-ethoxy-4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 46258224 |
| Molecular Formula | C20H17N5O3S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[[3-ethoxy-4-[(2-ethyl-5-oxo-[1,3,4]thiadiazolo[3,2-a]pyrimidin-7-yl)methoxy]phenyl]methylidene]propanedinitrile |
| SMILES | CCOc1cc(C=C(C#N)C#N)ccc1OCc1cc(=O)n2nc(CC)sc2n1 |
| InChI | InChI=1S/C20H17N5O3S/c1-3-18-24-25-19(26)9-15(23-20(25)29-18)12-28-16-6-5-13(7-14(10-21)11-22)8-17(16)27-4-2/h5-9H,3-4,12H2,1-2H3 |
| InChIKey | ILIMSDBMMNIDBC-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|